CAS 162148-48-3
:1,7-Bis(tert-butoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane
Description:
1,7-Bis(tert-butoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane is a complex organic compound characterized by its unique cyclic structure and multiple functional groups. This substance features a tetraazacyclododecane backbone, which consists of a twelve-membered ring containing four nitrogen atoms, contributing to its chelating properties. The presence of tert-butoxycarbonyl (Boc) groups enhances its stability and solubility, making it suitable for various applications in organic synthesis and coordination chemistry. The compound is typically used in the preparation of ligands for metal ions, facilitating the formation of metal complexes. Its structural characteristics allow for potential applications in drug delivery systems and as a building block in supramolecular chemistry. Additionally, the compound's ability to form stable complexes with transition metals can be exploited in catalysis and materials science. Overall, 1,7-Bis(tert-butoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane is notable for its versatility and functionality in various chemical contexts.
Formula:C20H40N4O4
InChI:InChI=1/C20H40N4O4/c1-19(2,3)27-17(25)15-23-11-7-21-9-13-24(14-10-22-8-12-23)16-18(26)28-20(4,5)6/h21-22H,7-16H2,1-6H3
SMILES:CC(C)(C)OC(=O)CN1CCNCCN(CCNCC1)CC(=O)OC(C)(C)C
Synonyms:- Di-Tert-Butyl 2,2'-(1,4,7,10-Tetraazacyclododecane-1,7-Diyl)Diacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,7-Bis(tert-butoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane
CAS:<p>Intermediate in the preparation of chelating agents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not ch</p>Formula:C20H40N4O4Color and Shape:Powder, WhiteMolecular weight:400.561,4,7,10-Tetraazacyclododecane-1,7-diacetic acid, 1,7-bis(1,1-dimethylethyl) ester
CAS:Formula:C20H40N4O4Purity:97%Color and Shape:SolidMolecular weight:400.5560Di-Tert-Butyl 2,2'-(1,4,7,10-Tetraazacyclododecane-1,7-Diyl)Diacetate
CAS:Di-Tert-Butyl 2,2'-(1,4,7,10-Tetraazacyclododecane-1,7-Diyl)DiacetatePurity:98%Molecular weight:400.56g/mol1,7-BIS(TERT-BUTOXYCARBONYLMETHYL)-1,4,7,10-TETRAAZACYCLODODECANE
CAS:Purity:97%Molecular weight:400.56399541,4,7,10-Tetraazacyclododecane-1,7-diacetic acid 1,7-bis(1,1-dimethylethyl) ester
CAS:<p>Please enquire for more information about 1,4,7,10-Tetraazacyclododecane-1,7-diacetic acid 1,7-bis(1,1-dimethylethyl) ester including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C20H40N4O4Purity:Min. 95%Color and Shape:PowderMolecular weight:400.56 g/mol




