CymitQuimica logo

CAS 1622069-62-8

:

Methyl 2-[[3-(3-methoxyphenyl)-5-isoxazolyl]amino]-2-oxoacetate

Description:
Methyl 2-[[3-(3-methoxyphenyl)-5-isoxazolyl]amino]-2-oxoacetate is a chemical compound characterized by its complex structure, which includes an isoxazole ring and a methoxyphenyl group. This compound typically exhibits properties associated with both the ester functional group and the presence of nitrogen in its structure, suggesting potential biological activity. The isoxazole moiety may contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The methyl ester group can influence its solubility and permeability, which are critical factors in drug design. Additionally, the presence of the amino group indicates potential for hydrogen bonding, which can affect its interaction with enzymes or receptors. Overall, this compound's unique structural features suggest it may have applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.
Formula:C13H12N2O5
InChI:InChI=1S/C13H12N2O5/c1-18-9-5-3-4-8(6-9)10-7-11(20-15-10)14-12(16)13(17)19-2/h3-7H,1-2H3,(H,14,16)
InChI key:InChIKey=HOGJRRCBRMXDGA-UHFFFAOYSA-N
SMILES:N(C(C(OC)=O)=O)C1=CC(=NO1)C2=CC(OC)=CC=C2
Synonyms:
  • Methyl 2-[[3-(3-methoxyphenyl)-5-isoxazolyl]amino]-2-oxoacetate
  • Acetic acid, 2-[[3-(3-methoxyphenyl)-5-isoxazolyl]amino]-2-oxo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.