CAS 1622351-34-1

Description:

The chemical substance with the CAS number 1622351-34-1 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), chemical reactivity, and potential applications. The characteristics of a chemical substance typically include its molecular formula, which indicates the types and numbers of atoms present, as well as its functional groups, which can influence its reactivity and interactions with other substances. Additionally, safety data sheets (SDS) provide crucial information regarding toxicity, handling, and storage requirements. For precise details about this specific compound, including its applications and safety considerations, consulting specialized chemical databases or literature is recommended.

Formula: C₇H₁₄N₂·2ClH

InChI: InChI=1/C7H14N2.2ClH/c1-9(2)7-5-3-8-4-6(5)7;;/h5-8H,3-4H2,1-2H3;2*1H/t5-,6+,7+;;

InChI key: InChIKey=BCRZWXCOXUVNPU-RUVWJRGXNA-N

SMILES: N(C)(C)[C@@H]1[C@@]2([C@]1(CNC2)[H])[H].Cl

rel-(1R,5S,6s)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine dihydrochloride

CAS: 1622351-34-1

rel-(1R,5S,6s)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine dihydrochloride

Purity: 98%

Molecular weight: 199.13g/mol

Ref: 54-OR1060773

rac-(1R,5S,6R)-N,N-Dimethyl-3-azabicyclo[3.1.0]hexan-6-amine dihydrochloride

CAS: 1622351-34-1

Versatile small molecule scaffold

Formula: C₇H₁₆Cl₂N₂

Purity: Min. 95%

Molecular weight: 199.12 g/mol

Ref: 3D-XPC35134