CAS 162240-93-9: Piperazine,2,6-dimethyl-, hydrochloride (1:2), (2R,6R)-

Description:Piperazine, 2,6-dimethyl-, hydrochloride (1:2), (2R,6R)- is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. This specific derivative features two methyl groups attached to the 2 and 6 positions of the piperazine ring, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. The (2R,6R) designation refers to the specific stereochemistry of the molecule, indicating that it has a defined three-dimensional arrangement that can affect its pharmacological properties. Piperazine derivatives are often studied for their potential therapeutic applications, including their use as anxiolytics, antidepressants, and in the treatment of various neurological disorders. The compound's properties, such as melting point, solubility, and reactivity, would be influenced by its molecular structure and the presence of functional groups.

Formula:C₆H₁₄N₂・2ClH

InChI:InChI=1S/C6H14N2.2ClH/c1-5-3-7-4-6(2)8-5;;/h5-8H,3-4H2,1-2H3;2*1H/t5-,6-;;/m1../s1

InChI key:InChIKey=SFOYHYMXNYOPAI-BNTLRKBRSA-N

SMILES:Cl.N1CC(NC(C)C1)C

Synonyms:
Piperazine, 2,6-dimethyl-,dihydrochloride, (2R-trans)-
Piperazine,2,6-dimethyl-, dihydrochloride, (2R,6R)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Piperazine, 2,6-dimethyl-, hydrochloride (1:2), (2R,6R)- REF: IN-DA001SX0CAS: 162240-93-9	97%	To inquire	Wed 26 Mar 25
(2R,6R)-2,6-Dimethylpiperazine Dihydrochloride REF: 54-OR1008000CAS: 162240-93-9	98%	32.00 €~2,189.00 €	Thu 27 Mar 25
(2R,6R)-2,6-Dimethylpiperazine dihydrochloride REF: 10-F378882CAS: 162240-93-9	95.0%	To inquire	Mon 07 Apr 25
(2R,6R)-2,6-dimethylpiperazine dihydrochloride REF: 3D-MGA24093CAS: 162240-93-9	Min. 95%	- - -	Discontinued product