
CAS 162252-46-2
:4-(Acetylamino)-3-amino-5-hydroxybenzoic acid
Description:
4-(Acetylamino)-3-amino-5-hydroxybenzoic acid, also known by its CAS number 162252-46-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple functional groups. This compound features an acetylamino group, an amino group, and a hydroxy group, contributing to its potential as a bioactive molecule. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding, which can influence its reactivity and interaction with biological systems. Additionally, the compound may possess antioxidant properties due to the hydroxy group, and its amino groups could facilitate interactions with various biomolecules. Its structural characteristics indicate potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Overall, 4-(Acetylamino)-3-amino-5-hydroxybenzoic acid represents a complex molecule with diverse chemical properties and potential utility in various fields of research.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-4(12)11-8-6(10)2-5(9(14)15)3-7(8)13/h2-3,13H,10H2,1H3,(H,11,12)(H,14,15)
InChI key:InChIKey=CALDTVBHJMBRTM-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(N)C=C(C(O)=O)C=C1O
Synonyms:- Benzoic acid, 4-(acetylamino)-3-amino-5-hydroxy-
- BANA 106
- 4-(Acetylamino)-3-hydroxy-5-aminobenzoic acid
- 4-(Acetylamino)-3-amino-5-hydroxybenzoic acid
- 3-Amino-4-acetamido-5-hydroxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
