CAS 162272-61-9
:4-Chloro-6-methyl-5-(phenylmethyl)-2-pyrimidinamine
Description:
4-Chloro-6-methyl-5-(phenylmethyl)-2-pyrimidinamine, with the CAS number 162272-61-9, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with a chlorine atom at the 4-position, a methyl group at the 6-position, and a phenylmethyl group at the 5-position. The presence of these substituents contributes to its unique chemical properties, including potential biological activity. The compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The chlorine and phenylmethyl groups can influence the compound's reactivity and interaction with biological targets, making it of interest in drug design and synthesis. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H12ClN3
InChI:InChI=1S/C12H12ClN3/c1-8-10(11(13)16-12(14)15-8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,14,15,16)
InChI key:InChIKey=NUGQOZJAWOOGSB-UHFFFAOYSA-N
SMILES:C(C=1C(C)=NC(N)=NC1Cl)C2=CC=CC=C2
Synonyms:- 4-Chloro-6-methyl-5-(phenylmethyl)-2-pyrimidinamine
- 2-Pyrimidinamine, 4-chloro-6-methyl-5-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.