CymitQuimica logo

CAS 162285-30-5

:

4-Oxazolidinecarboxylicacid, hydrochloride, (4S)- (9CI)

Description:
4-Oxazolidinecarboxylic acid, hydrochloride, (4S)-(9CI) is a chemical compound characterized by its oxazolidine ring structure, which features a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It is often used in pharmaceutical applications, particularly in the synthesis of various bioactive molecules, owing to its potential as a chiral building block. The (4S) designation indicates its specific stereochemistry, which is crucial for its biological activity and interactions. As a hydrochloride salt, it may exhibit different physical properties compared to its free acid form, such as altered melting points and solubility profiles. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken in laboratory or industrial settings.
Formula:C4H7NO3・ClH
InChI:InChI=1S/C4H7NO3.ClH/c6-4(7)3-1-8-2-5-3;/h3,5H,1-2H2,(H,6,7);1H
InChI key:QDWFSTLUZHSBAS-UHFFFAOYSA-N
SMILES:C1C(NCO1)C(=O)O.Cl
Synonyms:
  • 4-Oxazolidinecarboxylicacid, hydrochloride, (S)-
Found 4 products.