CAS 16229-24-6

THIENO[3,2-D]PYRIMIDINE-4-THIOL

Description:

Thieno[3,2-d]pyrimidine-4-thiol is a heterocyclic compound characterized by a fused ring system that includes both a thieno and a pyrimidine moiety. This compound features a thiol (-SH) functional group at the 4-position of the pyrimidine ring, which contributes to its reactivity and potential applications in various chemical reactions, particularly in the formation of disulfides or as a nucleophile in substitution reactions. The presence of sulfur in the thieno ring enhances its electronic properties, making it a candidate for use in medicinal chemistry and materials science. Thieno[3,2-d]pyrimidine derivatives have been studied for their biological activities, including antimicrobial and anticancer properties. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows for potential interactions with biological targets, making it of interest in drug development and synthetic chemistry. Safety data should be consulted for handling and usage, as thiol compounds can be sensitive to oxidation and may have specific toxicity profiles.

Formula: C₆H₄N₂S₂

InChI: InChI=1/C6H4N2S2/c9-6-5-4(1-2-10-5)7-3-8-6/h1-3H,(H,7,8,9)

SMILES: c1csc2c1ncnc2S

Synonyms:

• thieno[3,2-d]pyrimidine-4(1H)-thione
• thieno[3,2-d]pyrimidine-4-thiol

Thieno[3,2-d]pyrimidine-4(3H)-thione

CAS: 16229-24-6

Formula: C₆H₄N₂S₂

Purity: %

Molecular weight: 168.2394

Ref: IN-DA001SYS

Thieno[3,2-d]pyrimidine-4(3H)-thione

CAS: 16229-24-6

Thieno[3,2-d]pyrimidine-4(3H)-thione

Purity: ≥95%

Molecular weight: 168.24g/mol

Ref: 54-OR77460

1H,4H-thieno[3,2-d]pyrimidine-4-thione

CAS: 16229-24-6

Purity: 95+%

Molecular weight: 168.2299957

Ref: 10-F615694

Thieno[3,2-d]pyrimidine-4-thiol

CAS: 16229-24-6

Versatile small molecule scaffold

Formula: C₆H₄N₂S₂

Purity: Min. 95%

Molecular weight: 168.2 g/mol

Ref: 3D-RAA22924