CAS 162333-02-0
:2-Nitro-4-(trifluoromethyl)benzyl bromide
Description:
2-Nitro-4-(trifluoromethyl)benzyl bromide is an organic compound characterized by the presence of a nitro group and a trifluoromethyl group attached to a benzyl moiety. The nitro group (-NO2) is a strong electron-withdrawing group, which can influence the reactivity of the compound, particularly in electrophilic aromatic substitution reactions. The trifluoromethyl group (-CF3) is also electron-withdrawing and imparts unique properties, such as increased lipophilicity and stability against oxidation. The bromide substituent serves as a good leaving group, making this compound potentially useful in various synthetic applications, including nucleophilic substitution reactions. The presence of both electron-withdrawing groups can enhance the electrophilicity of the benzyl carbon, facilitating reactions with nucleophiles. Additionally, the compound's structure suggests potential applications in medicinal chemistry and materials science, where halogenated compounds are often explored for their biological activity and physical properties. Safety and handling precautions should be observed due to the presence of bromine and nitro functionalities, which can pose health and environmental risks.
Formula:C8H5BrF3NO2
InChI:InChI=1/C8H5BrF3NO2/c9-4-5-1-2-6(8(10,11)12)3-7(5)13(14)15/h1-3H,4H2
SMILES:c1cc(cc(c1CBr)N(=O)=O)C(F)(F)F
Synonyms:- 1-(Bromomethyl)-2-Nitro-4-(Trifluoromethyl)Benzene
- 2-Nitro-4-Trifluoromethylbromobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Nitro-4-(trifluoromethyl)benzyl bromide, 97%
CAS:<p>Used as intermediates. Also as laboratory reagents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not cha</p>Formula:C8H5BrF3NO3Purity:97%Color and Shape:Yellow, PowderMolecular weight:284.03Benzene, 1-(bromomethyl)-2-nitro-4-(trifluoromethyl)-
CAS:Formula:C8H5BrF3NO2Purity:97%Color and Shape:SolidMolecular weight:284.03002-Nitro-4-(trifluoromethyl)benzyl bromide
CAS:Formula:C8H5BrF3NO2Purity:97.0%Color and Shape:SolidMolecular weight:284.0322-Nitro-4-(trifluoromethyl)benzyl bromide
CAS:<p>2-Nitro-4-(trifluoromethyl)benzyl bromide</p>Formula:C8H5BrF3NO2Purity:97%Color and Shape: yellow powderMolecular weight:284.03g/mol



