CAS 162334-97-6

N-(2-bromo-5-hydroxy-4-methoxybenzyl)-N-[2-(3-bromo-4-hydroxyphenyl)ethyl]formamide

Description:

N-(2-bromo-5-hydroxy-4-methoxybenzyl)-N-[2-(3-bromo-4-hydroxyphenyl)ethyl]formamide is a complex organic compound characterized by its specific functional groups and structural features. It contains a formamide moiety, which is indicative of its potential reactivity and biological activity. The presence of bromine atoms suggests that the compound may exhibit unique electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions. The hydroxy and methoxy groups contribute to its polarity and solubility in polar solvents, while the aromatic rings provide stability and potential for π-π interactions. This compound may be of interest in medicinal chemistry due to its structural motifs, which are often associated with biological activity. Additionally, the specific arrangement of substituents can influence its pharmacokinetic properties, such as absorption and metabolism. Overall, the characteristics of this compound suggest it may have applications in drug development or as a research tool in biochemical studies.

Formula: C₁₇H₁₇Br₂NO₄

InChI: InChI=1/C17H17Br2NO4/c1-24-17-8-13(18)12(7-16(17)23)9-20(10-21)5-4-11-2-3-15(22)14(19)6-11/h2-3,6-8,10,22-23H,4-5,9H2,1H3

SMILES: COc1cc(c(cc1O)CN(CCc1ccc(c(c1)Br)O)C=O)Br

Formamide, N-[(2-bromo-5-hydroxy-4-methoxyphenyl)methyl]-N-[2-(3-bromo-4-hydroxyphenyl)ethyl]-

CAS: 162334-97-6

Formula: C₁₇H₁₇Br₂NO₄

Color and Shape: Solid

Molecular weight: 459.1292

Ref: IN-DA001T1B

N-(3-Bromo-4-hydroxyphenethyl)-N-(2-bromo-5-hydroxy-4-methoxybenzyl)formamide

Controlled Product

CAS: 162334-97-6

Please enquire for more information about N-(3-Bromo-4-hydroxyphenethyl)-N-(2-bromo-5-hydroxy-4-methoxybenzyl)formamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₁₇Br₂NO₄

Purity: Min. 95%

Molecular weight: 459.13 g/mol

Ref: 3D-FB19147