CAS 16234-15-4

2-Chloro-4-(morpholin-4-yl)thieno[3,2-d]pyrimidine

Description:

2-Chloro-4-(morpholin-4-yl)thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its unique structural features, which include a thieno[3,2-d]pyrimidine core and a morpholine substituent. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the chlorine atom and the morpholine group can influence its solubility, reactivity, and interaction with biological targets. Additionally, the thieno[3,2-d]pyrimidine structure contributes to its aromaticity and stability, making it a valuable compound in drug discovery. The compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of solvents. Overall, 2-Chloro-4-(morpholin-4-yl)thieno[3,2-d]pyrimidine is of interest in various fields, including organic synthesis and pharmacology, due to its diverse chemical behavior and potential therapeutic applications.

Formula: C₁₀H₁₀ClN₃OS

InChI: InChI=1/C10H10ClN3OS/c11-10-12-7-1-6-16-8(7)9(13-10)14-2-4-15-5-3-14/h1,6H,2-5H2

SMILES: c1csc2c1nc(Cl)nc2N1CCOCC1

Synonyms:

• 2-Chlor-4-(morpholin-4-yl)thieno[3,2-d]pyrimidin
• Thieno[3,2-D]Pyrimidine, 2-Chloro-4-(4-Morpholinyl)-
• 4-(2-Chlorothieno[3,2-D]Pyrimidin-4-Yl)Morpholine

Thieno[3,2-d]pyrimidine, 2-chloro-4-(4-morpholinyl)-

CAS: 16234-15-4

Formula: C₁₀H₁₀ClN₃OS

Purity: 97%

Color and Shape: Solid

Molecular weight: 255.7239

Ref: IN-DA001T1I

4-(2-Chlorothieno[3,2-d]pyrimidin-4-yl)morpholine

CAS: 16234-15-4

4-(2-Chlorothieno[3,2-d]pyrimidin-4-yl)morpholine

Purity: 98%

Molecular weight: 255.72g/mol

Ref: 54-OR302485

2-Chloro-4-(4-morpholinyl)thieno[3,2-d]pyrimidine

CAS: 16234-15-4

Formula: C₁₀H₁₀ClN₃OS

Purity: 98%

Molecular weight: 255.72

Ref: 10-F076072