CAS 16234-40-5

2-Chlorothieno[3,2-d]pyrimidin-4-amine

Description:

2-Chlorothieno[3,2-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyrimidine ring. The presence of a chlorine atom at the second position of the thieno ring and an amino group at the fourth position of the pyrimidine contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. It is of interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with similar structures have been investigated for their antiviral and anticancer properties. The molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₄ClN₃S

InChI: InChI=1/C6H4ClN3S/c7-6-9-3-1-2-11-4(3)5(8)10-6/h1-2H,(H2,8,9,10)

SMILES: c1csc2c1nc(Cl)[nH]c2=N

Synonyms:

• Thieno[3,2-D]Pyrimidin-4-Amine, 2-Chloro-
• 4-Amino-2-chlorothieno[3,2-d]pyrimidine

Thieno[3,2-d]pyrimidin-4-amine, 2-chloro-

CAS: 16234-40-5

Formula: C₆H₄ClN₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 185.6341

Ref: IN-DA001T1H

2-Chlorothieno[3,2-d]pyrimidin-4-amine

CAS: 16234-40-5

2-Chlorothieno[3,2-d]pyrimidin-4-amine

Purity: 95%

Molecular weight: 185.64g/mol

Ref: 54-OR1053551

4-Amino-2-chlorothieno[3,2-d]pyrimidine

CAS: 16234-40-5

Formula: C₆H₄ClN₃S

Purity: 95%

Molecular weight: 185.63

Ref: 10-F076421