CAS 162358-05-6
:2-(4-OCTYLPHENYL)ETHANOL
Description:
2-(4-Octylphenyl)ethanol, with the CAS number 162358-05-6, is an organic compound characterized by its structure, which features a phenolic group substituted with an octyl chain. This compound typically exhibits properties associated with both alcohols and aromatic compounds, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic octyl group. The presence of the hydroxyl (-OH) group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. This compound may be utilized in various applications, including as a surfactant or in the formulation of specialty chemicals. Its physical properties, such as boiling point and melting point, can vary based on the specific conditions and purity of the sample. Additionally, the octyl substituent can impart unique characteristics, such as increased hydrophobicity and potential applications in materials science or as a component in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C16H26O
InChI:InChI=1S/C16H26O/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)13-14-17/h9-12,17H,2-8,13-14H2,1H3
SMILES:CCCCCCCCc1ccc(cc1)CCO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Fingolimod Impurity 46
CAS:Formula:C16H26OColor and Shape:White To Off-White SolidMolecular weight:234.38Benzeneethanol, 4-octyl
CAS:Benzeneethanol, 4-octyl is a useful organic compound for research related to life sciences. The catalog number is T125667 and the CAS number is 162358-05-6.Formula:C16H26OColor and Shape:SolidMolecular weight:234.3832-(4-Octylphenyl)ethanol
CAS:Controlled Product<p>Applications 2-(4-Octylphenyl)ethanol (cas# 162358-05-6) is a compound useful in organic synthesis.<br></p>Formula:C16H26OColor and Shape:NeatMolecular weight:234.382-(4-Octylphenyl)ethanol
CAS:Formula:C16H26OPurity:97%Color and Shape:Liquid, No data available.Molecular weight:234.383






