CAS 162358-07-8
:Benzene, 1-(2-iodoethyl)-4-octyl-
Description:
Benzene, 1-(2-iodoethyl)-4-octyl- is an organic compound characterized by its structure, which includes a benzene ring substituted with a 4-octyl group and a 2-iodoethyl group. This compound belongs to the class of alkyl-substituted benzenes, which are known for their hydrophobic properties due to the long hydrocarbon chain. The presence of the iodine atom introduces a halogen functionality, which can influence the compound's reactivity and potential applications in organic synthesis or as an intermediate in chemical reactions. The octyl group contributes to the compound's lipophilicity, making it less soluble in water but more soluble in organic solvents. Additionally, the iodine substituent can participate in nucleophilic substitution reactions, making this compound of interest in medicinal chemistry and materials science. Overall, the unique combination of functional groups in Benzene, 1-(2-iodoethyl)-4-octyl- provides a versatile platform for further chemical modifications and applications.
Formula:C16H25I
InChI:InChI=1S/C16H25I/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)13-14-17/h9-12H,2-8,13-14H2,1H3
SMILES:CCCCCCCCc1ccc(cc1)CCI
Synonyms:- 1-(2-Iodoethyl)-4-Octylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
1-(2-Iodoethyl)-4-octylbenzene
CAS:Formula:C16H25IPurity:98%Color and Shape:LiquidMolecular weight:344.27421-(2-Iodoethyl)-4-octylbenzene
CAS:1-(2-Iodoethyl)-4-octylbenzenePurity:98%Molecular weight:344.27g/mol2-(4-Octylphenyl)-1-iodoethane
CAS:Formula:C16H25IPurity:≥ 97.0%Color and Shape:Colourless to yellow or brown liquidMolecular weight:344.271-(2-iodoethyl)-4-octylbenzene
CAS:<p>1-(2-iodoethyl)-4-octylbenzene is a useful organic compound for research related to life sciences.</p>Formula:C16H25IColor and Shape:SolidMolecular weight:344.282-(4-Octylphenyl)-1-iodoethane
CAS:Controlled Product<p>Applications 2-(4-Octylphenyl)-1-iodoethane (cas# 162358-07-8) is a compound useful in organic synthesis.<br></p>Formula:C16H25IColor and Shape:NeatMolecular weight:344.271-(2-Iodoethyl)-4-octylbenzene
CAS:Formula:C16H25IPurity:95%Color and Shape:OilMolecular weight:344.282-(4-Octylphenyl)-1-iodoethane
CAS:<p>2-(4-Octylphenyl)-1-iodoethane is a drug substance that has been shown to have potent anti-cancer activity in biological studies. The compound is an analog of the pharmaceutical agent fty720, which is being studied for its potential use as a treatment for multiple sclerosis. This compound may be used in the treatment of cancer and associated conditions such as inflammatory diseases. 2-(4-Octylphenyl)-1-iodoethane activates regulatory phosphatases, which are enzymes that regulate cellular processes such as DNA repair and cell cycle progression. Activating these enzymes can lead to a decrease in tumor size and growth. 2-(4-Octylphenyl)-1-iodoethane may also act by inhibiting the production of styrene, which is an impurity found in this drug substance.</p>Formula:C16H25IPurity:Min. 95%Molecular weight:344.27 g/mol









