CAS 1623791-77-4
:4,7,10,13,17-Pentaoxa-16-phosphanonadecanoic acid, 16-ethoxy-, 1,1-dimethylethyl ester, 16-oxide
Description:
4,7,10,13,17-Pentaoxa-16-phosphanonadecanoic acid, 16-ethoxy-, 1,1-dimethylethyl ester, 16-oxide, identified by its CAS number 1623791-77-4, is a complex organic compound characterized by its unique structure that includes multiple ether and phosphonate functionalities. This compound features a long carbon chain, which contributes to its hydrophobic properties, while the presence of oxygen and phosphorus atoms introduces polar characteristics, potentially enhancing solubility in various solvents. The ester functional group suggests that it may exhibit reactivity typical of esters, such as hydrolysis under acidic or basic conditions. Additionally, the presence of the ethoxy group indicates potential for further chemical modifications or applications in organic synthesis. Its structural complexity may also imply specific biological activities or applications in fields such as pharmaceuticals or materials science. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential uses in various chemical contexts.
Formula:C19H39O9P
InChI:InChI=1S/C19H39O9P/c1-6-26-29(21,27-7-2)17-16-25-15-14-24-13-12-23-11-10-22-9-8-18(20)28-19(3,4)5/h6-17H2,1-5H3
InChI key:InChIKey=NFPXAIMWNSOSKO-UHFFFAOYSA-N
SMILES:P(CCOCCOCCOCCOCCC(OC(C)(C)C)=O)(OCC)(OCC)=O
Synonyms:- 4,7,10,13,17-Pentaoxa-16-phosphanonadecanoic acid, 16-ethoxy-, 1,1-dimethylethyl ester, 16-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,7,10,13,17-Pentaoxa-16-phosphanonadecanoic acid, 16-ethoxy-, 1,1-dimethylethyl ester, 16-oxide
CAS:Formula:C19H39O9PMolecular weight:442.4813Boc-PEG4-phosphonic acid ethyl ester
CAS:<p>Boc-PEG4-phosphonic acid ethyl ester: PEG-based linker for PROTAC synthesis.</p>Formula:C19H39O9PPurity:98%Color and Shape:SolidMolecular weight:442.48t-Butyoxycarboxy-PEG4-phosphonic acidethyl ester
CAS:<p>t-Butyoxycarboxy-PEG4-phosphonic acidethyl ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. t-Butyoxycarboxy-PEG4-phosphonic acidethyl ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.</p>Formula:C19H39O9PPurity:Min. 95%Molecular weight:442.5 g/mol


