CAS 162401-70-9
:4-Difluoromethoxy-3-Methoxy-Benzaldehyde
Description:
4-Difluoromethoxy-3-methoxy-benzaldehyde, with the CAS number 162401-70-9, is an organic compound characterized by the presence of both difluoromethoxy and methoxy functional groups attached to a benzaldehyde structure. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic nature. The difluoromethoxy group introduces significant electronegativity, influencing the compound's reactivity and polarity. The methoxy group contributes to the compound's overall stability and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the aldehyde functional group allows for further derivatization, making it a valuable intermediate in organic synthesis. Its unique structural features may also impart specific biological activities, making it of interest in medicinal chemistry and material science. As with many organic compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and reactivity.
Formula:C9H8F2O3
InChI:InChI=1/C9H8F2O3/c1-13-8-4-6(5-12)2-3-7(8)14-9(10)11/h2-5,9H,1H3
SMILES:COc1cc(ccc1OC(F)F)C=O
Synonyms:- Asinex-Reag Bas 11524503
- Art-Chem-Bb B014002
- Akos B014002
- Akos Bbs-00006582
- Timtec-Bb Sbb009330
- 4-(Difluoromethoxy)-3-Methoxybenzaldehyde
- 3-Methoxy-4-(difluoromethoxy)benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzaldehyde, 4-(difluoromethoxy)-3-methoxy-
CAS:Formula:C9H8F2O3Purity:98%Color and Shape:LiquidMolecular weight:202.15484-(Difluoromethoxy)-3-methoxybenzaldehyde
CAS:4-(Difluoromethoxy)-3-methoxybenzaldehydeFormula:C9H8F2O3Purity:97%Color and Shape: clear. light orange liquidMolecular weight:202.15g/mol3-Methoxy-4-(difluoromethoxy)benzaldehyde
CAS:<p>3-Methoxy-4-(difluoromethoxy)benzaldehyde is a chemical compound that has been found to have anti-tumor properties. It inhibits tumor cells by inducing cell apoptosis. 3-Methoxy-4-(difluoromethoxy)benzaldehyde induces apoptosis in human carcinoma cells, with optimal activity at doses of 10 micromolar and higher. This chemical can be used as an anti-tumor agent because it shows no genotoxic effects, and has high yield with a low toxicity profile. When this compound is exposed to UV radiation, the formation of reactive oxygen species (ROS) increases the rate of cell death. 3-Methoxy-4-(difluoromethoxy)benzaldehyde also has anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis.</p>Formula:C9H8F2O3Purity:Min. 95%Color and Shape:Colourless To Pale Yellow LiquidMolecular weight:202.15 g/mol4-DIFLUOROMETHOXY-3-METHOXYBENZALDEHYDE
CAS:Formula:C9H8F2O3Purity:98%Color and Shape:LiquidMolecular weight:202.157



