CAS 162402-35-9

4-(4-Piperidinyloxy)phenol

Description:

4-(4-Piperidinyloxy)phenol, with the CAS number 162402-35-9, is a chemical compound characterized by its phenolic structure, which features a piperidine ring substituted with a hydroxyl group. This compound is known for its potential applications in medicinal chemistry, particularly as a pharmacological agent due to its ability to interact with various biological targets. The presence of the piperidine moiety contributes to its lipophilicity, enhancing its ability to penetrate biological membranes. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. The compound may exhibit antioxidant properties, making it of interest in studies related to oxidative stress and neuroprotection. Its structural features suggest that it could be involved in various biochemical pathways, and ongoing research may explore its efficacy and safety in therapeutic contexts. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any potential hazards associated with its use.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1S/C11H15NO2/c13-9-1-3-10(4-2-9)14-11-5-7-12-8-6-11/h1-4,11-13H,5-8H2

InChI key: InChIKey=HIUJTTVXPJHTEL-UHFFFAOYSA-N

SMILES: O(C1=CC=C(O)C=C1)C2CCNCC2

Synonyms:

• Phenol, 4-(4-piperidinyloxy)-
• 4-(4-Piperidinyloxy)phenol