CAS 162402-37-1
:4-(3-Methoxyphenoxy)piperidine
Description:
4-(3-Methoxyphenoxy)piperidine, identified by its CAS number 162402-37-1, is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methoxyphenoxy substituent, indicating the presence of a methoxy group (-OCH3) attached to a phenyl ring that is further connected to the piperidine structure via an ether linkage. The presence of the methoxy group enhances the compound's lipophilicity, potentially influencing its biological activity and solubility in organic solvents. 4-(3-Methoxyphenoxy)piperidine may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, and its synthesis typically involves standard organic reactions such as ether formation and piperidine ring modifications. As with many organic compounds, its stability, reactivity, and interactions can vary based on environmental conditions and the presence of other functional groups.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-14-11-3-2-4-12(9-11)15-10-5-7-13-8-6-10/h2-4,9-10,13H,5-8H2,1H3
InChI key:InChIKey=DNZZLFXWMVOBBV-UHFFFAOYSA-N
SMILES:O(C1=CC(OC)=CC=C1)C2CCNCC2
Synonyms:- Piperidine, 4-(3-Methoxyphenoxy)-
- 4-(3-Methoxyphenoxy)piperidine
- 4-(3-Methoxyphenoxy)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
