CAS 162408-66-4: 4'-ACETYL-N-[4-[4-(2-METHOXYPHENYL)-1-PIPERAZINYL]BUTYL]-[1,1'-BIPHENYL]-4-CARBOXAMIDE
Description:4'-Acetyl-N-[4-[4-(2-methoxyphenyl)-1-piperazinyl]butyl]-[1,1'-biphenyl]-4-carboxamide, with CAS number 162408-66-4, is a synthetic organic compound characterized by its complex structure, which includes a biphenyl core, a piperazine moiety, and an acetyl and carboxamide functional group. This compound exhibits properties typical of pharmaceuticals, particularly in the realm of neuropharmacology, where it may interact with neurotransmitter systems. The presence of the methoxyphenyl group suggests potential lipophilicity, which can influence its bioavailability and pharmacokinetics. The piperazine ring is often associated with various biological activities, including anxiolytic and antipsychotic effects. Additionally, the carboxamide group may enhance solubility in polar solvents, facilitating its interaction with biological targets. Overall, this compound's structural features indicate potential utility in medicinal chemistry, particularly in the development of therapeutic agents targeting central nervous system disorders. However, specific biological activity and safety profiles would require further empirical investigation.
Formula:C30H35N3O3
InChI:InChI=1/C30H35N3O3/c1-23(34)24-9-11-25(12-10-24)26-13-15-27(16-14-26)30(35)31-17-5-6-18-32-19-21-33(22-20-32)28-7-3-4-8-29(28)36-2/h3-4,7-16H,5-6,17-22H2,1-2H3,(H,31,35)
- Synonyms:
- Gr 103691
- 4'-acetyl-N-{4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl}biphenyl-4-carboxamide