
CAS 162424-67-1
:(+)-(1R,5S,6S)-7-(6-Amino-1-methyl-3-azabicyclo[3.2.0]hept-3-yl)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid hydrochloride
Description:
The chemical substance known as (+)-(1R,5S,6S)-7-(6-Amino-1-methyl-3-azabicyclo[3.2.0]hept-3-yl)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid hydrochloride, with the CAS number 162424-67-1, is a synthetic compound that belongs to the class of naphthyridine derivatives. It exhibits a complex molecular structure characterized by multiple functional groups, including a carboxylic acid and a fluorine atom, which contribute to its biological activity. This compound is primarily recognized for its potential pharmacological properties, particularly as an antibacterial agent. The presence of the bicyclic amine structure enhances its interaction with biological targets, potentially influencing its efficacy and selectivity. Additionally, the hydrochloride form indicates that it is a salt, which can affect its solubility and stability in various environments. Overall, this compound's unique stereochemistry and functional groups make it a subject of interest in medicinal chemistry and drug development.
Formula:C19H22ClFN4O3
InChI:InChI=1/C19H21FN4O3.ClH/c1-19-5-14(21)12(19)7-23(8-19)17-13(20)4-10-15(25)11(18(26)27)6-24(9-2-3-9)16(10)22-17;/h4,6,9,12,14H,2-3,5,7-8,21H2,1H3,(H,26,27);1H/t12-,14-,19-;/m0./s1
Synonyms:- Ecenofloxacin hydrochloride
- CFC-222
- 7-[(1R,5S,6S)-6-amino-1-methyl-3-azabicyclo[3.2.0]hept-3-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid hydrochloride (1:1)
- 1,8-Naphthyridine-3-carboxylic acid, 7-[(1R,5S,6S)-6-amino-1-methyl-3-azabicyclo[3.2.0]hept-3-yl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-, monohydrochloride, rel-(+)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ecenofloxacin HCl
CAS:<p>Ecenofloxacin HCl, the salt form of Ecenofloxacin, is a novel fluoroquinolone antibiotic exhibiting potent antibacterial activity against Gram-positive bacteria, Gram-negative bacteria, and anaerobes.</p>Formula:C19H22ClFN4O3Color and Shape:SolidMolecular weight:408.85
