CAS 1624262-16-3: 6-Bromo-3-pyridinyl N-(1-methylethyl)carbamate
Description:6-Bromo-3-pyridinyl N-(1-methylethyl)carbamate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a carbamate functional group. The presence of the bromine atom enhances its reactivity and potential biological activity. The N-(1-methylethyl) group indicates that the compound has an isopropyl substituent, which can influence its solubility and interaction with biological systems. This compound is likely to exhibit properties typical of carbamates, such as potential use in agricultural applications as a pesticide or herbicide, due to its ability to inhibit certain enzymes. Additionally, the pyridine ring may contribute to its pharmacological properties, making it a candidate for further investigation in medicinal chemistry. The compound's molecular weight, solubility, and stability would depend on its specific structural features and the conditions under which it is studied. As with many chemical substances, safety data and handling precautions are essential for its use in laboratory or industrial settings.
Formula:C9H11BrN2O2
InChI:InChI=1S/C9H11BrN2O2/c1-6(2)12-9(13)14-7-3-4-8(10)11-5-7/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=YEXPSWXNQXCIOJ-UHFFFAOYSA-N
SMILES:O=C(OC1=CN=C(Br)C=C1)NC(C)C
- Synonyms:
- 6-Bromo-3-pyridinyl N-(1-methylethyl)carbamate
- Carbamic acid, N-(1-methylethyl)-, 6-bromo-3-pyridinyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Carbamic acid, N-(1-methylethyl)-, 6-bromo-3-pyridinyl ester REF: IN-DA001T5ACAS: 1624262-16-3 | - - - | To inquire | Wed 12 Mar 25 |
 | 6-Bromopyridin-3-yl isopropylcarbamate REF: 54-OR302221CAS: 1624262-16-3 | - - - | To inquire | Wed 19 Mar 25 |
 | 6-Bromopyridin-3-yl isopropylcarbamate REF: 10-F770597CAS: 1624262-16-3 | 98% | - - - | Discontinued product |
 | 6-Bromopyridin-3-yl isopropylcarbamate REF: 3D-ZPC26216CAS: 1624262-16-3 | Min. 95% | - - - | Discontinued product |
Carbamic acid, N-(1-methylethyl)-, 6-bromo-3-pyridinyl ester
Ref: IN-DA001T5A
| Undefined size | To inquire |
Ref: 54-OR302221
| Undefined size | To inquire |
Ref: 10-F770597
| 1g | Discontinued | Request information |
6-Bromopyridin-3-yl isopropylcarbamate
Ref: 3D-ZPC26216
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
