CAS 1624262-33-4

2,4-Pyrrolidinedione, 1,5-dimethyl-, acetate (1:3)

Description:

2,4-Pyrrolidinedione, 1,5-dimethyl-, acetate (1:3), with the CAS number 1624262-33-4, is a chemical compound that belongs to the class of pyrrolidinediones. This substance typically exhibits characteristics such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to be soluble in organic solvents, which is common for many derivatives of pyrrolidinedione. The presence of acetate groups suggests that it may have functional properties related to ester chemistry, potentially influencing its reactivity and interactions with other compounds. Additionally, the dimethyl substitution at the 1 and 5 positions of the pyrrolidine ring can affect its steric and electronic properties, which may play a role in its biological activity or utility in synthetic applications. As with many chemical substances, safety data sheets should be consulted for handling, storage, and potential hazards associated with this compound.

Formula: C₆H₉NO₂·3C₂H₄O₂

InChI: InChI=1S/C6H9NO2.C2H4O2/c1-4-5(8)3-6(9)7(4)2;1-2(3)4/h4H,3H2,1-2H3;1H3,(H,3,4)

InChI key: InChIKey=UYEZTNABNIHNEO-UHFFFAOYSA-N

SMILES: CC1N(C)C(=O)CC1=O.C(C)(O)=O

Synonyms:

• 2,4-Pyrrolidinedione, 1,5-dimethyl-, acetate (1:3)

1,5-Dimethylpyrrolidine-2,4-dione triacetate

CAS: 1624262-33-4

Formula: C₁₂H₂₁NO₈

Molecular weight: 307.2970

Ref: IN-DA001T52

1,5-Dimethylpyrrolidine-2,4-dione triacetate

CAS: 1624262-33-4

Formula: C₁₂H₂₁NO₈

Purity: 95.0%

Molecular weight: 307.299

Ref: 10-F462574