CAS 16250-08-1
:2-AMINOPYRIDINE-5-SULFONIC ACID
Description:
2-Aminopyridine-5-sulfonic acid is an organic compound characterized by its pyridine ring, which is substituted with an amino group and a sulfonic acid group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its hydrophilicity. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. It is often used in biochemical applications, such as in the synthesis of dyes, pharmaceuticals, and as a reagent in analytical chemistry. The sulfonic acid group imparts strong acidic properties, making it a useful intermediate in organic synthesis. Additionally, 2-aminopyridine-5-sulfonic acid may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H6N2O3S
InChI:InChI=1/C5H6N2O3S/c6-5-2-1-4(3-7-5)11(8,9)10/h1-3H,(H2,6,7)(H,8,9,10)
SMILES:c1cc(=N)[nH]cc1S(=O)(=O)O
Synonyms:- 2-Aminopyridine-5-Sulphonic Acid
- 6-Aminopyridine-3-Sulfonic Acid
- Akos Bbs-00001355
- Aurora 12418
- Otava-Bb Bb0111070132
- 2-Amino-5-Pyridinesulfonic Acid
- 6-Amino-3-pyridinesulfonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Pyridinesulfonic acid, 6-amino-
CAS:Formula:C5H6N2O3SPurity:98%Color and Shape:SolidMolecular weight:174.17776-Aminopyridine-3-sulphonic acid
CAS:6-Aminopyridine-3-sulphonic acidPurity:98%Color and Shape:Off-White PowderMolecular weight:174.18g/mol2-Aminopyridine-5-sulfonic acid
CAS:2-Aminopyridine-5-sulfonic acid is an alkaline hydrolysis product of benzene and water. It is an organic compound that is classified as a heterocyclic amine. The molecule has a pyridine ring with two nitrogen atoms in the ring. 2-Aminopyridine-5-sulfonic acid has been shown to be used as a ligand for coordination of ruthenium metal ions, which has been studied by theory and experiment. This ligand was also found to be able to coordinate halides such as chloride, bromide, or iodide ions. 2-Aminopyridine-5-sulfonic acid can exist in two different isomers: (S)-2-(benzyloxycarbonylamino)pyridine 5 sulfonic acid or (R)-2-(benzyloxycarbonylamino)pyridine 5 sulfonic acid.Formula:C5H6N2O3SPurity:Min. 95%Color and Shape:SolidMolecular weight:174.18 g/mol2-Aminopyridine-5-sulfonic Acid
CAS:Controlled ProductFormula:C5H6N2O3SColor and Shape:NeatMolecular weight:174.18




