CAS 162515-68-6
:1-(MERCAPTOMETHYL)-CYCLOPROPANEACETIC ACID
Description:
1-(Mercaptomethyl)-cyclopropaneacetic acid, with the CAS number 162515-68-6, is a chemical compound characterized by its unique structure that includes a cyclopropane ring and a mercaptomethyl group. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The presence of the mercaptomethyl group introduces thiol characteristics, making it reactive and capable of forming disulfide bonds or participating in nucleophilic reactions. The cyclopropane ring adds strain to the molecular structure, influencing its reactivity and stability. This compound may exhibit biological activity, potentially serving as a building block in pharmaceuticals or agrochemicals. Its solubility and reactivity can vary depending on the surrounding environment, such as pH and the presence of other functional groups. Overall, 1-(mercaptomethyl)-cyclopropaneacetic acid is notable for its structural features that combine cyclic, thiol, and carboxylic acid functionalities, which can lead to diverse applications in organic synthesis and medicinal chemistry.
Formula:C6H10O2S
InChI:InChI=1/C6H10O2S/c7-5(8)3-6(4-9)1-2-6/h9H,1-4H2,(H,7,8)
InChI key:InChIKey=VFAXPOVKNPTBTM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1(CS)CC1
Synonyms:- 1-(Mercaptomethyl)-cyclopropylacetic acid
- 1-(Mercaptomethyl)cyclopropane acetic acid
- 1-(Mercaptomethyl)cyclopropane acetic acid(B3)
- 1-(Mercaptomethyl)cyclopropyl acetic acid
- 1-(Sulfanylmethyl)cyclopropaneacetic acid
- 2-[1-(Mercaptomethyl)Cyclopropyl]Acetic Acid
- 2-[1-(Merocaptomethyl)Cyclopropyl]Acetic Acid
- 2-[1-(Sulfanylmethyl)cyclopropyl]acetic acid
- Cyclopropaneacetic acid, 1-(mercaptomethyl)-
- Montelukast Intermdiates
- [1-(Sulfanylmethyl)Cyclopropyl]Acetic Acid
- 1-(Mercaptomethyl)cyclopropaneacetic acid
- 1-(mercaptomethyl)cyclopropaneacetic acid
- 1-(Mercaptomethyl)-Cyclopropyl
- 1-(mercaptomethyl)cyclopropane acetic acid (intermediate of montelukast)
- Montelukast Sodium-2-[1-(mercaptomethyl)cyclopropyl]acetic acid
- 1-(MECAPTOMETHYL)CYCLOPROPYL]ACETIC ACID[FOR MONTELUKAST]
- 2-[1-(Mercaptomethyl)cycloprop
- Montelukast intermediate
- 2-[1-(mercaptomethyl)cyclopropyl]acetic acid (intermediate of montelukast)
- 1-(Hydroxymethyl)cyclopropaneacetonitrile
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
1-(Mercaptomethyl)cyclopropaneacetic Acid (2-[1-(Sulfanylmethyl)cyclopropyl]acetic Acid)
CAS:Color and Shape:Neat1-(Mercaptomethyl)cyclopropaneacetic Acid
CAS:Formula:C6H10O2SPurity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:146.20[1-(Thiomethyl)cycloprop-1-yl]acetic acid
CAS:[1-(Thiomethyl)cycloprop-1-yl]acetic acidFormula:C6H10O2SPurity:97%Color and Shape: white crystalline solidMolecular weight:146.21g/mol1-(Mercaptomethyl)cyclopropaneacetic Acid
CAS:Controlled Product<p>Applications An intermediate of Montelukast.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C6H10O2SColor and Shape:NeatMolecular weight:146.21[1-(Mercaptomethyl)cyclopropyl]acetic acid
CAS:Formula:C6H10O2SPurity:97%Color and Shape:SolidMolecular weight:146.21-(Mercaptomethyl)cyclopropaneacetic acid
CAS:<p>1-(Mercaptomethyl)cyclopropaneacetic acid is a reaction product of hydrolysis, transfer, and industrialization. It is used in the synthesis of organic compounds such as quinolinediols and thioureas. 1-(Mercaptomethyl)cyclopropaneacetic acid is typically prepared by the reaction of an alkylsulfonyl chloride with an inorganic base such as lithium or sodium carbonate in an organic solvent such as acetonitrile. The compound is also used to produce other organosulfur compounds, including imino sulfides and disulfides.</p>Formula:C6H10O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:146.21 g/molCyclopropaneacetic acid, 1-(mercaptomethyl)-
CAS:Formula:C6H10O2SPurity:95%Color and Shape:SolidMolecular weight:146.20742-(1-(Mercaptomethyl)cyclopropyl)acetic acid
CAS:<p>2-(1-(Mercaptomethyl)cyclopropyl)acetic acid is a useful organic compound for research related to life sciences. The catalog number is T65784 and the CAS number is 162515-68-6.</p>Formula:C6H10O2SColor and Shape:SolidMolecular weight:146.2









