CAS 16252-88-3

5-Nitrobenzo-2,1,3-thiadiazole

Description:

5-Nitrobenzo-2,1,3-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring fused to a nitro-substituted benzene moiety. This compound features a five-membered ring containing two nitrogen atoms and one sulfur atom, contributing to its unique chemical properties. The nitro group (-NO2) is an electron-withdrawing substituent, which can influence the compound's reactivity and stability. Typically, 5-nitrobenzo-2,1,3-thiadiazole exhibits moderate solubility in organic solvents, and its structure allows for potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. The presence of both the nitro group and the thiadiazole ring can impart interesting electronic and photophysical properties, making it a subject of interest for research in organic synthesis and functional materials. Additionally, the compound may exhibit biological activity, which warrants further investigation into its potential uses in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₆H₃N₃O₂S

InChI: InChI=1/C6H3N3O2S/c10-9(11)4-1-2-5-6(3-4)8-12-7-5/h1-3H

SMILES: c1cc2c(cc1N(=O)=O)nsn2

Synonyms:

• 5-(Hydroxy(oxido)amino)-2,1,3-benzothiadiazole
• Nsc 169218
• 5-Nitro-2,1,3-Benzothiadiazole

2,1,3-Benzothiadiazole, 5-nitro-

CAS: 16252-88-3

Formula: C₆H₃N₃O₂S

Purity: %

Color and Shape: Solid

Molecular weight: 181.1719

Ref: IN-DA001T8B

5-Nitrobenzo[c][1,2,5]thiadiazole

CAS: 16252-88-3

5-Nitrobenzo[c][1,2,5]thiadiazole

Purity: 95%

Ref: 54-OR1042098

5-Nitrobenzo[c][1,2,5]thiadiazole

CAS: 16252-88-3

Formula: C₆H₃N₃O₂S

Purity: 95+%

Molecular weight: 181.17

Ref: 10-F437398