CAS 16255-50-8
:1,4-Bis(chloromethyl)-2-nitrobenzene
Description:
1,4-Bis(chloromethyl)-2-nitrobenzene is an organic compound characterized by its nitro and chloromethyl substituents on a benzene ring. It features a nitro group (-NO2) positioned at the 2-position and two chloromethyl groups (-CH2Cl) at the 1 and 4 positions of the benzene ring, making it a member of the nitro-substituted aromatic compounds. This compound is typically a solid at room temperature and may exhibit a yellow to brown color. It is known for its reactivity due to the presence of the chloromethyl groups, which can participate in nucleophilic substitution reactions. The nitro group contributes to the compound's electron-withdrawing properties, influencing its chemical behavior and reactivity. 1,4-Bis(chloromethyl)-2-nitrobenzene is used in various chemical syntheses and may serve as an intermediate in the production of other chemical compounds. Safety precautions are necessary when handling this substance, as it may pose health risks, including toxicity and potential environmental hazards.
Formula:C8H7Cl2NO2
InChI:InChI=1S/C8H7Cl2NO2/c9-4-6-1-2-7(5-10)8(3-6)11(12)13/h1-3H,4-5H2
InChI key:InChIKey=AJBJABQEANMSMG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(CCl)C=CC(CCl)=C1
Synonyms:- 1,4-Bis(chloromethyl)-2-nitrobenzene
- 1-Nitro-2,5-bis-(chloromethyl)benzene
- 2-Nitro-p-xylylene dichloride
- 2-Nitro-p-xylylenedichloride
- Nsc 525118
- p-Xylene, a,a'-dichloro-2-nitro- (7CI,8CI)
- p-Xylene, α,α′-dichloro-2-nitro-
- Benzene, 1,4-bis(chloromethyl)-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.