CAS 16256-42-1: 2,2,5,5-Tetramethyl-4-imidazolidinone
Description:2,2,5,5-Tetramethyl-4-imidazolidinone, commonly referred to as TMI, is a cyclic organic compound characterized by its imidazolidinone structure, which features a five-membered ring containing nitrogen atoms. This compound is typically a colorless to pale yellow liquid with a relatively high boiling point and low volatility, making it suitable for various applications in organic synthesis and as a solvent. TMI is known for its ability to act as a polar aprotic solvent, facilitating reactions involving nucleophiles and electrophiles. It exhibits good thermal stability and is soluble in a range of organic solvents, which enhances its utility in chemical processes. Additionally, TMI can participate in various chemical reactions, including those involving carbonyl compounds, due to its nucleophilic properties. Safety data indicates that while TMI is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure. Overall, its unique properties make it valuable in both industrial and laboratory settings.
Formula:C7H14N2O
InChI:InChI=1S/C7H14N2O/c1-6(2)5(10)8-7(3,4)9-6/h9H,1-4H3,(H,8,10)
InChI key:InChIKey=GOZUKDFGVNBSAZ-UHFFFAOYSA-N
SMILES:O=C1NC(NC1(C)C)(C)C
- Synonyms:
- 2,2,5,5-Tetramethyl-4-imidazolidinone
- 4-Imidazolidinone, 2,2,5,5-tetramethyl-
- 2,2,5,5-Tetramethyl-4-oxoimidazolidine
- 2,2,5,5-Tetramethylimidazolidin-4-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,2,5,5-Tetramethylimidazolidin-4-one REF: IN-DA007DYPCAS: 16256-42-1 | - - - | To inquire | Mon 14 Apr 25 |
![]() | 2,2,5,5-Tetramethylimidazolidin-4-one REF: 10-F749420CAS: 16256-42-1 | 95+% | - - - | Discontinued product |
![]() | 2,2,5,5-Tetramethylimidazolidin-4-one REF: 3D-RAA25642CAS: 16256-42-1 | Min. 95% | - - - | Discontinued product |

Ref: 10-F749420
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |

2,2,5,5-Tetramethylimidazolidin-4-one
Ref: 3D-RAA25642
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |