CymitQuimica logo

CAS 16257-89-9

:

(2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride

Description:
(2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride, commonly known as L-4-aminoproline, is an amino acid derivative characterized by its pyrrolidine ring structure. This compound features a chiral center, which contributes to its specific stereochemistry, denoted by the (2S,4R) configuration. It is a white to off-white crystalline solid that is soluble in water, making it suitable for various biochemical applications. The presence of both an amino group and a carboxylic acid group allows it to participate in typical amino acid reactions, including peptide bond formation. This compound is of interest in pharmaceutical research, particularly in the development of inhibitors and as a building block in the synthesis of bioactive molecules. Its dihydrochloride form indicates that it exists as a salt, which can enhance its stability and solubility in aqueous solutions. Overall, (2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride is a valuable compound in organic synthesis and medicinal chemistry.
Formula:C5H12Cl2N2O2
InChI:InChI=1/C5H10N2O2.2ClH/c6-3-1-4(5(8)9)7-2-3;;/h3-4,7H,1-2,6H2,(H,8,9);2*1H/t3-,4+;;/m1../s1
InChI key:YQEVKNLEXCXBHR-KTMCEXHZSA-N
SMILES:C1[C@H](CN[C@@H]1C(=O)O)N.Cl.Cl
Found 4 products.