CymitQuimica logo

CAS 162576-01-4

:

Benzyl (2-aminoethyl)methylcarbamate hydrochloride (1:1)

Description:
Benzyl (2-aminoethyl)methylcarbamate hydrochloride is a chemical compound characterized by its structure, which includes a benzyl group, an aminoethyl chain, and a carbamate functional group. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit biological activity due to the presence of the amino group, which can participate in various biochemical interactions. It is often used in research settings, particularly in studies related to medicinal chemistry and drug development. The hydrochloride form can also influence the compound's stability and bioavailability. Safety data sheets would typically indicate handling precautions, as with many organic compounds, due to potential irritant properties. Overall, Benzyl (2-aminoethyl)methylcarbamate hydrochloride is a versatile compound with potential applications in medicinal chemistry, although specific biological activities and mechanisms would require further investigation.
Formula:C11H17ClN2O2
InChI:InChI=1S/C11H16N2O2.ClH/c1-13(8-7-12)11(14)15-9-10-5-3-2-4-6-10;/h2-6H,7-9,12H2,1H3;1H
InChI key:UXWLBNDYLILRTJ-UHFFFAOYSA-N
SMILES:CN(CCN)C(=O)OCc1ccccc1.Cl
Found 4 products.