CAS 16260-06-3

(3Z)-3-(2-chloro-10-oxido-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine

Description:

The chemical substance known as (3Z)-3-(2-chloro-10-oxido-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine, with the CAS number 16260-06-3, exhibits several notable characteristics. It is a synthetic organic compound that features a thioxanthene core, which is a polycyclic aromatic structure known for its potential applications in pharmaceuticals and dyes. The presence of a chlorine atom and an oxido group contributes to its reactivity and may influence its biological activity. The dimethylpropan-1-amine moiety suggests that the compound may possess basic properties, potentially allowing it to interact with biological systems. Its Z-configuration indicates a specific geometric arrangement around the double bond, which can affect its physical properties and reactivity. Overall, this compound may be of interest in medicinal chemistry due to its unique structural features, which could lead to diverse applications in drug development or as a chemical probe in biological research. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₈H₁₈ClNOS

InChI: InChI=1/C18H18ClNOS/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)22(21)18-10-9-13(19)12-16(14)18/h3-4,6-10,12H,5,11H2,1-2H3/b14-7-

SMILES: CN(C)CC/C=C\1/c2ccccc2S(=O)c2ccc(cc12)Cl

Synonyms:

• 1-Propanamine, 3-(2-chloro-10-oxido-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, (Z)-

Chlorprothixene sulfoxide oxalate

CAS: 16260-06-3

Please enquire for more information about Chlorprothixene sulfoxide oxalate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₈H₁₈ClNOS

Purity: Min. 95%

Molecular weight: 331.9 g/mol

Ref: 3D-RAA26006