CymitQuimica logo

CAS 162607-21-8

:

B-(5-Methoxy-2-thienyl)boronic acid

Description:
B-(5-Methoxy-2-thienyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thienyl ring that is further substituted with a methoxy group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having a moderate melting point. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the methoxy group can influence the electronic properties and reactivity of the compound, potentially enhancing its solubility and stability. Additionally, the thienyl ring contributes to the compound's aromatic character, which can affect its interactions with other molecules. Overall, B-(5-Methoxy-2-thienyl)boronic acid is a versatile building block in the synthesis of complex organic molecules and has applications in the development of pharmaceuticals and agrochemicals.
Formula:C5H7BO3S
InChI:InChI=1S/C5H7BO3S/c1-9-5-3-2-4(10-5)6(7)8/h2-3,7-8H,1H3
InChI key:InChIKey=OODNCJSCAOATOX-UHFFFAOYSA-N
SMILES:B(O)(O)C=1SC(OC)=CC1
Synonyms:
  • B-(5-Methoxy-2-thienyl)boronic acid
  • Boronic acid, (5-methoxy-2-thienyl)-
  • Boronic acid, B-(5-methoxy-2-thienyl)-
  • (5-Methoxythien-2-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.