CAS 16261-80-6
:4-(2-Hydroxyhexafluoroisopropyl)benzoic acid
Description:
4-(2-Hydroxyhexafluoroisopropyl)benzoic acid, with the CAS number 16261-80-6, is a fluorinated organic compound characterized by the presence of a benzoic acid moiety substituted with a hydroxyalkyl group that contains hexafluoroisopropyl groups. This compound typically exhibits properties associated with both aromatic and fluorinated compounds, such as increased hydrophobicity and thermal stability due to the presence of fluorine atoms. The hydroxyl group contributes to its potential for hydrogen bonding, which can influence solubility and reactivity. The presence of the carboxylic acid functional group indicates that it can act as an acid, participating in various chemical reactions, including esterification and neutralization. Additionally, the fluorinated structure may impart unique characteristics, such as resistance to chemical degradation and enhanced performance in specific applications, including pharmaceuticals and materials science. Overall, this compound's unique structure and functional groups make it of interest in various chemical and industrial applications.
Formula:C10H6F6O3
InChI:InChI=1/C10H6F6O3/c11-9(12,13)8(19,10(14,15)16)6-3-1-5(2-4-6)7(17)18/h1-4,19H,(H,17,18)
SMILES:c1cc(ccc1C(=O)O)C(C(F)(F)F)(C(F)(F)F)O
Synonyms:- 4-(1,1,1,3,3,3-Hexafluoro-2-Hydroxypropan-2-Yl)Benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(2-Hydroxyhexafluoroisopropyl)benzoic acid, 97%
CAS:4-(2-Hydroxyhexafluoroisopropyl) benzoic acid is used in chemicals, pharmaceutical research, acts as a pharmaceutical intermediate and reagent. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer t
Formula:C10H6F6O3Purity:97%Color and Shape:White to cream or pale yellow, PowderMolecular weight:288.154-(2-Hydroxyhexafluoroisopropyl)Benzoic Acid
CAS:Formula:C10H6F6O3Purity:97%Molecular weight:288.14334-(1,1,1,3,3,3-Hexafluoro-2-hydroxyprop-2-yl)benzoic acid
CAS:4-(1,1,1,3,3,3-Hexafluoro-2-hydroxyprop-2-yl)benzoic acidFormula:C10H6F6O3Purity:97%Color and Shape: white crystalline solidMolecular weight:288.14g/mol


