CAS 16263-52-8

3-chloro-1,2-benzisoxazole

Description:

3-Chloro-1,2-benzisoxazole is a heterocyclic organic compound characterized by its fused benzene and isoxazole rings, with a chlorine substituent at the 3-position of the isoxazole. This compound typically appears as a solid and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the chlorine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. 3-Chloro-1,2-benzisoxazole is often utilized in medicinal chemistry and material science due to its potential biological activity and ability to serve as a building block for more complex molecules. Its solubility can vary depending on the solvent, and it may exhibit moderate to high melting points. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 3-chloro-1,2-benzisoxazole is a valuable compound in synthetic organic chemistry with applications in drug development and research.

Formula: C₇H₄ClNO

InChI: InChI=1/C7H4ClNO/c8-7-5-3-1-2-4-6(5)10-9-7/h1-4H

SMILES: c1ccc2c(c1)c(Cl)no2

Synonyms:

• 1,2-Benzisoxazole, 3-chloro-
• 3-Chlorobenzo[D]Isoxazole
• 3-Chloro-1,2-Benzoxazole

3-Chloro-1,2-benzisoxazole

CAS: 16263-52-8

Formula: C₇H₄ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.5658

Ref: IN-DA007WUJ

3-Chloro-1,2-benzisoxazole

CAS: 16263-52-8

3-Chloro-1,2-benzisoxazole

Purity: ≥95%

Color and Shape: Brown Solid

Molecular weight: 153.57g/mol

Ref: 54-OR25968

3-Chloro-1,2-benzisoxazole

CAS: 16263-52-8

Formula: C₇H₄ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F067548