CAS 1626337-90-3

5-Bromo-2,3-difluorobenzamide

Description:

5-Bromo-2,3-difluorobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with bromine and fluorine atoms, as well as an amide functional group. The presence of the bromine atom at the 5-position and two fluorine atoms at the 2 and 3 positions of the benzene ring contributes to its unique chemical properties, including increased reactivity and potential for hydrogen bonding due to the amide group. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the presence of halogens can influence the compound's solubility, stability, and interaction with biological systems. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.

Formula: C₇H₄BrF₂NO

InChI: InChI=1S/C7H4BrF2NO/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H2,11,12)

InChI key: InChIKey=GPOZYURDVJMILC-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(F)C(F)=CC(Br)=C1

Synonyms:

• Benzamide, 5-bromo-2,3-difluoro-
• 5-Bromo-2,3-difluorobenzamide

5-Bromo-2,3-difluorobenzamide

CAS: 1626337-90-3

5-Bromo-2,3-difluorobenzamide

Purity: ≥95%

Molecular weight: 236.01g/mol

Ref: 54-PC303430