
CAS 162635-10-1
:1,3-Dioxane-5-carboxylic acid, 2,2,5-trimethyl-, anhydride with 2,4,6-trichlorobenzoic acid
Description:
1,3-Dioxane-5-carboxylic acid, 2,2,5-trimethyl-, anhydride with 2,4,6-trichlorobenzoic acid, identified by CAS number 162635-10-1, is a complex organic compound characterized by its unique structural features. This substance contains a dioxane ring, which contributes to its cyclic ether properties, and a carboxylic acid moiety that enhances its reactivity and potential for forming derivatives. The presence of the anhydride functional group indicates that it can undergo hydrolysis or react with nucleophiles, making it useful in various chemical syntheses. Additionally, the incorporation of 2,4,6-trichlorobenzoic acid introduces significant electronegative chlorine substituents, which can influence the compound's reactivity, solubility, and overall stability. This compound may exhibit interesting biological activities and could be of interest in pharmaceutical or agrochemical applications. However, due to its complex structure, detailed studies on its physical and chemical properties, such as solubility, melting point, and reactivity, would be necessary to fully understand its behavior in different environments.
Formula:C15H15Cl3O5
InChI:InChI=1S/C15H15Cl3O5/c1-14(2)21-6-15(3,7-22-14)13(20)23-12(19)11-9(17)4-8(16)5-10(11)18/h4-5H,6-7H2,1-3H3
InChI key:InChIKey=FZTHYIFJZAFXJQ-UHFFFAOYSA-N
SMILES:C(OC(=O)C1(C)COC(C)(C)OC1)(=O)C2=C(Cl)C=C(Cl)C=C2Cl
Synonyms:- 2,2,5-Trimethyl[1,3]dioxane-5-carboxylic 2,4,6-trichlorobenzoic anhydride
- 1,3-Dioxane-5-carboxylic acid, 2,2,5-trimethyl-, anhydride with 2,4,6-trichlorobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
