CAS 16264-11-2

1-(CHLOROACETYL)-4-(4-NITROPHENYL)PIPERAZINE

Description:

1-(Chloroacetyl)-4-(4-nitrophenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a chloroacetyl group at one position and a nitrophenyl group at another introduces significant functional diversity, influencing its reactivity and potential applications. This compound typically exhibits moderate to high solubility in polar organic solvents due to the presence of polar functional groups. Its structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The nitro group can serve as a site for further chemical modifications, while the chloroacetyl moiety may participate in nucleophilic substitution reactions. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 1-(Chloroacetyl)-4-(4-nitrophenyl)piperazine is a versatile compound with implications in both synthetic chemistry and pharmacology.

Formula: C₁₂H₁₄ClN₃O₃

InChI: InChI=1/C12H14ClN3O3/c13-9-12(17)15-7-5-14(6-8-15)10-1-3-11(4-2-10)16(18)19/h1-4H,5-9H2

SMILES: c1cc(ccc1N1CCN(CC1)C(=O)CCl)N(=O)=O

Synonyms:

• Ethanone, 2-Chloro-1-[4-(4-Nitrophenyl)-1-Piperazinyl]-

2-Chloro-1-[4-(4-nitrophenyl)-1-piperazinyl]ethanone

CAS: 16264-11-2

Formula: C₁₂H₁₄ClN₃O₃

Molecular weight: 283.7109

Ref: IN-DA001TAF

2-Chloro-1-[4-(4-nitrophenyl)-1-piperazinyl]ethanone

CAS: 16264-11-2

Purity: 98%

Molecular weight: 283.7099915

Ref: 10-F649727