CAS 16265-11-5
:4-Bromo-2-methylimidazole
Description:
4-Bromo-2-methylimidazole is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound is typically a white to light yellow solid and is soluble in polar solvents such as water and alcohols. It exhibits basic properties due to the nitrogen atoms in the imidazole ring, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. 4-Bromo-2-methylimidazole is often used in pharmaceutical research and as a building block in organic synthesis, particularly in the development of biologically active compounds. Its reactivity and functionalization potential make it valuable in medicinal chemistry and materials science. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C4H5BrN2
InChI:InChI=1/C4H5BrN2/c1-3-6-2-4(5)7-3/h2H,1H3,(H,6,7)
InChI key:InChIKey=APLZLUYWLINBOZ-UHFFFAOYSA-N
SMILES:BrC=1NC(C)=NC1
Synonyms:- 1H-Imidazole, 4-bromo-2-methyl-
- 1H-Imidazole, 5-bromo-2-methyl-
- 4-Bromo-2-methyl-1H-imidazole
- 5-bromo-2-methyl-1H-imidazole
- Imidazole, 4-bromo-2-methyl-
- 4-Bromo-2-methylimidazole
- 2-Methyl-4-bromo-1H-imidazole
- 4-Bromo-2-methyl-1H-imidazole 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole, 5-bromo-2-methyl-
CAS:Formula:C4H5BrN2Purity:98%Color and Shape:SolidMolecular weight:160.9999Ref: IN-DA001TA9
1g56.00€5g131.00€10g183.00€25g286.00€250gTo inquire500gTo inquire100mg31.00€250mg31.00€4-Bromo-2-methyl-1H-imidazole
CAS:4-Bromo-2-methyl-1H-imidazoleFormula:C4H5BrN2Purity:98%Color and Shape: white solidMolecular weight:161.00g/mol4-Bromo-2-methyl-1H-imidazole
CAS:Formula:C4H5BrN2Purity:98%Color and Shape:SolidMolecular weight:161.0024-Bromo-2-methyl-1H-imidazole
CAS:4-Bromo-2-methyl-1H-imidazole is a carboxylic acid derivative that has been shown to function as a catalyst. It has been used in the synthesis of imidazoles, succinimides, and acylamino derivatives. 4-Bromo-2-methyl-1H-imidazole also has an acidic nature, which makes it useful for the synthesis of esters and amides from carboxylic acids. This compound can be used in the preparation of glycosides by reacting with sugars. 4-Bromo-2-methyl-1H-imidazole is also able to form radicals when heated with oxygen or sodium nitrite. The radical formed will react with alkyl halides and trifluoromethanesulfonic anhydride to form acyl halides and trifluoromethanesulfonamides respectively.Formula:C4H5BrN2Purity:Min. 95%Molecular weight:161 g/mol



