CAS 16265-37-5

N-Acetyladenosine

Description:

N-Acetyladenosine is a nucleoside derivative of adenosine, characterized by the presence of an acetyl group attached to the nitrogen atom at the 1-position of the adenine moiety. This modification alters its biochemical properties and enhances its stability compared to adenosine. N-Acetyladenosine is soluble in water and exhibits a polar nature due to its hydroxyl and amino groups, which can participate in hydrogen bonding. It plays a role in various biological processes, including cellular signaling and metabolism. The compound is often studied for its potential therapeutic applications, particularly in the context of neuroprotection and anti-inflammatory effects. Its molecular structure consists of a purine base (adenine) linked to a ribose sugar, making it a key component in the synthesis of nucleotides and nucleic acids. Additionally, N-Acetyladenosine can be involved in the regulation of cellular energy levels and is a subject of interest in pharmacological research. Overall, its unique structural features and biological significance make it a valuable compound in biochemistry and medicinal chemistry.

Formula: C₁₂H₁₅N₅O₅

InChI: InChI=1S/C12H15N5O5/c1-5(19)16-10-7-11(14-3-13-10)17(4-15-7)12-9(21)8(20)6(2-18)22-12/h3-4,6,8-9,12,18,20-21H,2H2,1H3,(H,13,14,16,19)/t6-,8-,9-,12-/m1/s1

InChI key: InChIKey=SLLVJTURCPWLTP-WOUKDFQISA-N

SMILES: O[C@H]1[C@H](N2C=3C(N=C2)=C(NC(C)=O)N=CN3)O[C@H](CO)[C@H]1O

Synonyms:

• Adenosine, N-acetyl-
• N-Acetyladenosine
• Acetamide, N-(9-β-D-ribofuranosyl-9H-purin-6-yl)-

N6-Acetyl adenosine

CAS: 16265-37-5

Formula: C₁₂H₁₅N₅O₅

Purity: 98%

Molecular weight: 309.2780

Ref: IN-DA001TB6

N6-Acetyl adenosine

CAS: 16265-37-5

Nucleoside Derivatives –Naturally modified ribo-nucleosides;Other modified nucleosides

Formula: C₁₂H₁₅N₅O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 309.28

Ref: TM-TNU0860

N-Acetyladenosine

CAS: 16265-37-5

N-Acetyladenosine

Purity: 98%

Molecular weight: 309.28g/mol

Ref: 54-BICL5014

N-Acetyladenosine

CAS: 16265-37-5

Ref: 7W-GC6851

N6-Acetyladenosine

CAS: 16265-37-5

N6-Acetyladenosine is a nucleoside that belongs to the group of N-acetylated adenosines. It is found in thermophilic organisms and has been shown to be involved in optimal growth. N6-Acetyladenosine has also been found to be an important part of the coding and population modifications of crenarchaeota, archaeal organisms that are phylogenetically related to methanogens. Unfractionated populations of methanogen contain both N6-acetyladenosine residues and other modified adenosines, with each organism differing in the types of modifications they contain. Transfer of these modified adenosines from one organism to another can lead to changes in their coding and population modifications.

Formula: C₁₂H₁₅N₅O₅

Purity: Area-% Min. 90 Area-%

Color and Shape: White Powder

Molecular weight: 309.28 g/mol

Ref: 3D-NA159478