CymitQuimica logo

CAS 162651-08-3

:

5-Thiazolecarboxylic acid, 2-bromo-4-ethyl-

Description:
5-Thiazolecarboxylic acid, 2-bromo-4-ethyl- is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a bromine atom at the 2-position and an ethyl group at the 4-position of the thiazole ring introduces specific steric and electronic effects, influencing its reactivity and potential applications. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various interactions, including hydrogen bonding and potential coordination with metal ions. Additionally, the compound's solubility and stability can vary based on environmental conditions, such as pH and temperature. Overall, 5-Thiazolecarboxylic acid, 2-bromo-4-ethyl- is a versatile compound with potential utility in synthetic chemistry and medicinal applications.
Formula:C6H6BrNO2S
InChI:InChI=1S/C6H6BrNO2S/c1-2-3-4(5(9)10)11-6(7)8-3/h2H2,1H3,(H,9,10)
InChI key:InChIKey=UJAWSAVHFAQCOQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(CC)N=C(Br)S1
Synonyms:
  • 5-Thiazolecarboxylic acid, 2-bromo-4-ethyl-
  • 2-Bromo-4-ethylthiazole-5-carboxylic acid
  • 2-Bromo-4-ethyl-1,3-thiazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.