CAS 162654-65-1
:Diisopropyl 1,1-cyclopropane-dicarboxylate
Description:
Diisopropyl 1,1-cyclopropane-dicarboxylate is an organic compound characterized by its structure, which includes two isopropyl ester groups attached to a cyclopropane ring with two carboxylate functionalities. This compound typically appears as a colorless to pale yellow liquid and is known for its low volatility and relatively low solubility in water, making it more soluble in organic solvents. It is often utilized in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of the cyclopropane moiety contributes to its unique reactivity, allowing it to participate in various chemical reactions, including cycloadditions and rearrangements. Additionally, diisopropyl 1,1-cyclopropane-dicarboxylate may exhibit specific properties such as moderate stability under standard conditions, but it should be handled with care due to potential reactivity. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines to ensure safe usage in laboratory or industrial settings.
Formula:C11H18O4
InChI:InChI=1/C11H18O4/c1-7(2)14-9(12)11(5-6-11)10(13)15-8(3)4/h7-8H,5-6H2,1-4H3
SMILES:CC(C)OC(=O)C1(CC1)C(=O)OC(C)C
Synonyms:- 1,1-Cyclopropanedicarboxylic Acid, Bis(1-Methylethyl) Ester
- Diisopropyl cyclopropane-1,1-dicarboxylate
- Bis(1-Methylethyl) Cyclopropane-1,1-Dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1-Cyclopropanedicarboxylic acid, 1,1-bis(1-methylethyl) ester
CAS:Formula:C11H18O4Molecular weight:214.2582
