CAS 162662-27-3

[4-(Methoxymethoxy)phenyl]-boronic acid

Description:

[4-(Methoxymethoxy)phenyl]-boronic acid, with the CAS number 162662-27-3, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a methoxymethoxy group. This compound typically exhibits properties such as good solubility in organic solvents and moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and materials science. The methoxymethoxy substituent enhances the compound's reactivity and solubility, making it useful in medicinal chemistry and the development of pharmaceuticals. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug delivery systems. Overall, [4-(Methoxymethoxy)phenyl]-boronic acid serves as a versatile building block in synthetic chemistry, with potential applications in various fields, including organic synthesis and materials science.

Formula: C₈H₁₁BO₃

InChI: InChI=1/C8H11BO3/c1-12-6-7-2-4-8(5-3-7)9(10)11/h2-5,10-11H,6H2,1H3

SMILES: COCc1ccc(cc1)B(O)O

Synonyms:

• 4-(Methoxymethyl)phenylboronic acid
• [4-(Methoxymethyl)Phenyl]Boronic Acid

Boronic acid, B-[4-(methoxymethoxy)phenyl]-

CAS: 162662-27-3

Formula: C₈H₁₁BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 181.9815

Ref: IN-DA001TAM

4-(Methoxymethoxy)phenylboronic acid

CAS: 162662-27-3

4-(Methoxymethoxy)phenylboronic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 181.98g/mol

Ref: 54-OR360049

(4-(Methoxymethoxy)phenyl)boronic acid

CAS: 162662-27-3

Formula: C₈H₁₁BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 181.98

Ref: 10-F219068