CAS 16269-13-9
:2-(1-adamantyl)acetonitrile
Description:
2-(1-Adamantyl)acetonitrile, with the CAS number 16269-13-9, is an organic compound characterized by its unique adamantyl group, which is a bicyclic structure known for its stability and rigidity. This compound features a nitrile functional group (-C≡N) attached to an acetonitrile backbone, contributing to its polar nature. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the adamantyl moiety imparts distinctive steric and electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. Its synthesis often involves the reaction of adamantyl derivatives with acetonitrile or related compounds. The compound's solubility is generally moderate in polar solvents, and it may exhibit interesting reactivity due to the nitrile group, which can participate in nucleophilic addition reactions. Overall, 2-(1-adamantyl)acetonitrile is notable for its structural features and potential utility in organic synthesis and medicinal chemistry.
Formula:C12H17N
InChI:InChI=1/C12H17N/c13-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,1,3-8H2
SMILES:C(C#N)C12CC3CC(CC(C3)C2)C1
Synonyms:- 1-Adamantaneacetonitrile
- Tricyclo[3.3.1.1~3,7~]Dec-1-Ylacetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Adamantaneacetonitrile, 97%
CAS:1-Adamantaneacetonitrile is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referencFormula:C12H17NPurity:97%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:175.281-Adamantyl acetonitrile
CAS:1-Adamantyl acetonitrile is a trifluoroacetic acid derivative that is used in the synthesis of 4-aminoantipyrine, chlorides, acid chlorides, and acetonitrile. 1-Adamantyl acetonitrile can be used to produce a variety of pharmaceuticals, such as aliphatic carboxylic acids, aldehydes, and amide. It can also serve as a reactant for reactions with alcohols or amines.
Formula:C12H17NPurity:Min. 95%Color and Shape:PowderMolecular weight:175.27 g/mol



