CAS 16269-66-2
:4-chlorothieno[3,2-d]pyrimidine
Description:
4-Chlorothieno[3,2-d]pyrimidine is a heterocyclic compound characterized by a fused ring system that includes both a thieno and a pyrimidine moiety. This compound features a chlorine substituent at the 4-position of the thieno ring, which can influence its reactivity and biological activity. It typically exhibits a pale to light yellow appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the thieno and pyrimidine rings contributes to its potential as a pharmacophore in medicinal chemistry, as these structures are often associated with various biological activities, including antimicrobial and anticancer properties. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be used as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H3ClN2S
InChI:InChI=1/C6H3ClN2S/c7-4-2-10-5-1-8-3-9-6(4)5/h1-3H
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Thieno[3,2-d]pyrimidine, 4-chloro-
CAS:Formula:C6H3ClN2SPurity:97%Color and Shape:SolidMolecular weight:170.61944-Chlorothieno[3,2-d]pyrimidine
CAS:4-Chlorothieno[3,2-d]pyrimidinePurity:≥98%Molecular weight:170.61g/mol4-Chlorothieno[3,2-d]pyrimidine
CAS:4-Chlorothieno[3,2-d]pyrimidine is a molecular block that can be used as a component of phase transfer catalysts.Formula:C6H3ClN2SPurity:99.09%Color and Shape:SolidMolecular weight:170.614-Chlorothieno[3,2-d]pyrimidine
CAS:4-Chlorothieno[3,2-d]pyrimidineFormula:C6H3ClN2SPurity:97%Color and Shape: yellow crystalline powderMolecular weight:170.62g/mol4-Chlorothieno[3,2-D]pyrimidine
CAS:Formula:C6H3ClN2SPurity:97%Color and Shape:SolidMolecular weight:170.61



