
CAS 162698-37-5
:2-Azetidinecarboxylic acid, ethyl ester, (R)-
Description:
2-Azetidinecarboxylic acid, ethyl ester, (R)-, with the CAS number 162698-37-5, is a chiral compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The (R)- designation indicates its specific stereochemistry, which can influence its biological activity and interactions with other molecules. Typically, compounds like this may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and the ability to participate in various chemical reactions, including esterification and nucleophilic substitutions. Its chiral nature makes it of particular interest in the development of pharmaceuticals, where enantiomeric purity can significantly affect therapeutic efficacy and safety. Overall, 2-Azetidinecarboxylic acid, ethyl ester, (R)- is a valuable compound in the field of synthetic organic chemistry and drug development.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-2-9-6(8)5-3-4-7-5/h5,7H,2-4H2,1H3/t5-/m1/s1
InChI key:InChIKey=WBAZVXJXZJXWOR-RXMQYKEDSA-N
SMILES:C(OCC)(=O)[C@H]1CCN1
Synonyms:- 2-Azetidinecarboxylic acid, ethyl ester, (R)-
- 2-Azetidinecarboxylic acid ethyl ester (r)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.