CAS 1627-30-1

4-METHYL-2H-[1,2,4]TRIAZINE-3,5-DIONE

Description:

4-Methyl-2H-[1,2,4]triazine-3,5-dione, with the CAS number 1627-30-1, is a heterocyclic organic compound characterized by its triazine ring structure, which contains nitrogen atoms in addition to carbon. This compound typically appears as a crystalline solid and is known for its stability under standard conditions. It features two carbonyl groups (C=O) at the 3 and 5 positions of the triazine ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of the methyl group at the 4 position influences its solubility and polarity, making it more soluble in organic solvents. 4-Methyl-2H-[1,2,4]triazine-3,5-dione is often studied for its potential use in agricultural chemistry, particularly as a herbicide or in the synthesis of other chemical compounds. Its unique structure allows for various functionalizations, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₄H₅N₃O₂

InChI: InChI=1/C4H5N3O2/c1-7-3(8)2-5-6-4(7)9/h2H,1H3,(H,6,9)

SMILES: Cn1c(=O)cnnc1O

Synonyms:

• Aids125025
• 4-methyl-1,2,4-triazine-3,5(2H,4H)-dione

1,2,4-Triazine-3,5(2H,4H)-dione, 4-methyl-

CAS: 1627-30-1

Formula: C₄H₅N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 127.1014

Ref: IN-DA001TCI

4-Methyl-2H-[1,2,4]triazine-3,5-dione

CAS: 1627-30-1

4-Methyl-2H-[1,2,4]triazine-3,5-dione

Purity: 95%

Molecular weight: 127.103g/mol

Ref: 54-OR97577

4-Methyl-2H-[1,2,4]triazine-3,5-dione

CAS: 1627-30-1

Formula: C₄H₅N₃O₂

Purity: 95%

Molecular weight: 127.103

Ref: 10-F438088