CAS 162739-99-3

4-Thiazolecarboxylic acid, 2-(1-pyrrolidinyl)-, ethyl ester

Description:

4-Thiazolecarboxylic acid, 2-(1-pyrrolidinyl)-, ethyl ester, identified by its CAS number 162739-99-3, is a chemical compound characterized by its thiazole and pyrrolidine functional groups. This compound typically exhibits properties associated with both heterocyclic compounds and esters, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid moiety. The thiazole ring contributes to its aromatic character and may influence its biological activity, while the pyrrolidine group can enhance its lipophilicity and interaction with biological targets. This compound may be of interest in medicinal chemistry for its potential pharmacological properties, including antimicrobial or anti-inflammatory activities. Its synthesis and characterization would involve standard organic chemistry techniques, and it may serve as a building block for further chemical modifications or as a lead compound in drug discovery. As with many chemical substances, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.

Formula: C₁₀H₁₄N₂O₂S

InChI: InChI=1S/C10H14N2O2S/c1-2-14-9(13)8-7-15-10(11-8)12-5-3-4-6-12/h7H,2-6H2,1H3

InChI key: InChIKey=RABHEYZDUXRSLO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N=C(SC1)N2CCCC2

Synonyms:

• 2-Pyrrolidin-1-yl-thiazole-4-carboxylic acid ethyl ester
• 4-Thiazolecarboxylic acid, 2-(1-pyrrolidinyl)-, ethyl ester
• Ethyl 2-(1-pyrrolidinyl)thiazole-4-carboxylate