CAS 162744-60-7

5-Bromo-2-(bromomethyl)-1,3-difluorobenzene

Description:

5-Bromo-2-(bromomethyl)-1,3-difluorobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple halogen atoms. Specifically, it features two bromine atoms and two fluorine atoms attached to the benzene ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of bromomethyl indicates a bromine atom is attached to a methylene group, enhancing its electrophilic properties. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitution reactions. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the halogen substituents influence the compound's polarity and overall stability, making it a subject of interest in materials science and medicinal chemistry. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₇H₄Br₂F₂

InChI: InChI=1S/C7H4Br2F2/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2

InChI key: InChIKey=VSKMLLGUWKLTQV-UHFFFAOYSA-N

SMILES: C(Br)C1=C(F)C=C(Br)C=C1F

Synonyms:

• 5-Bromo-2-(Bromomethyl)-1,3-Difluorobenzene
• Benzene, 5-bromo-2-(bromomethyl)-1,3-difluoro-
• 4-Bromo-2,6-difluorobenzyl bromide

Benzene, 5-bromo-2-(bromomethyl)-1,3-difluoro-

CAS: 162744-60-7

Formula: C₇H₄Br₂F₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 285.9115

Ref: IN-DA001TEH

4-Bromo-2,6-difluorobenzyl bromide

CAS: 162744-60-7

4-Bromo-2,6-difluorobenzyl bromide

Formula: C₇H₄Br₂F₂

Purity: 98%

Color and Shape: clear. almost colourless to pale lemon fused solid / liquid

Molecular weight: 285.91g/mol

Ref: 54-PC8241

4-Bromo-2,6-difluorobenzyl bromide

CAS: 162744-60-7

Formula: C₇H₄Br₂F₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 285.914

Ref: 10-F047008