CAS 1627716-57-7

7-(3,5-Dimethyl-4-isoxazolyl)-4-(6-fluoro-4-quinolinyl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indole

Description:

7-(3,5-Dimethyl-4-isoxazolyl)-4-(6-fluoro-4-quinolinyl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indole, with the CAS number 1627716-57-7, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features multiple functional groups, including isoxazole, quinoline, and pyrimidine moieties, which contribute to its potential biological activity. The presence of fluorine in the quinoline ring may enhance its lipophilicity and influence its pharmacokinetic properties. The methoxy and dimethyl substituents can affect the compound's solubility and reactivity. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of oncology and neurology, due to their ability to interact with various biological targets. The intricate arrangement of atoms and the presence of multiple rings suggest that this substance may exhibit unique electronic properties, making it a candidate for further research in medicinal chemistry. However, specific biological activities and safety profiles would require empirical studies to establish its efficacy and toxicity.

Formula: C₂₆H₂₀FN₅O₂

InChI: InChI=1S/C26H20FN5O2/c1-12-23(13(2)34-32-12)19-10-21-18(11-22(19)33-4)24-25(29-14(3)30-26(24)31-21)16-7-8-28-20-6-5-15(27)9-17(16)20/h5-11H,1-4H3,(H,29,30,31)

InChI key: InChIKey=VPVRJBDAKQJNHC-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C3=C(N=C(C)N=C3NC2=CC1C=4C(C)=NOC4C)C=5C6=C(N=CC5)C=CC(F)=C6

Synonyms:

• 7-(3,5-Dimethyl-4-isoxazolyl)-4-(6-fluoro-4-quinolinyl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indole
• 9H-Pyrimido[4,5-b]indole, 7-(3,5-dimethyl-4-isoxazolyl)-4-(6-fluoro-4-quinolinyl)-6-methoxy-2-methyl-

CD235

CAS: 1627716-57-7

CD235 is a structurally similar analog of CD161. CD161 is an orally bioavailable inhibitor of BET bromodomain.

Formula: C₂₆H₂₀FN₅O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 453.47

Ref: TM-T10720