CymitQuimica logo

CAS 162848-23-9

:

5-Bromo-4-methoxy-3-thiophenecarboxylic acid

Description:
5-Bromo-4-methoxy-3-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which includes a bromine atom, a methoxy group, and a thiophene ring. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, particularly in the field of medicinal chemistry. The methoxy group contributes to the compound's solubility and can influence its electronic properties, enhancing its potential as a building block in organic synthesis. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts additional stability and can participate in various chemical reactions, such as electrophilic substitutions. This compound is typically used in research settings, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity. Its carboxylic acid functional group also allows for further derivatization, making it versatile in synthetic pathways. Overall, 5-Bromo-4-methoxy-3-thiophenecarboxylic acid is a valuable compound in organic chemistry with diverse applications.
Formula:C6H5BrO3S
InChI:InChI=1S/C6H5BrO3S/c1-10-4-3(6(8)9)2-11-5(4)7/h2H,1H3,(H,8,9)
InChI key:InChIKey=OMNYIQIDPSRNES-UHFFFAOYSA-N
SMILES:O(C)C=1C(C(O)=O)=CSC1Br
Synonyms:
  • 2-Bromo-3-methoxythiophene-4-carboxylic acid
  • 5-Bromo-4-methoxythiophene-3-carboxylic acid
  • 5-Bromo-4-methoxy-3-thiophenecarboxylic acid
  • 3-Thiophenecarboxylic acid, 5-bromo-4-methoxy-
Found 3 products.