CymitQuimica logo

CAS 162848-25-1

:

3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid

Description:
3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a nitro group and a pyrazole ring. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's reactivity and solubility. The pyrazole ring, a five-membered heterocyclic structure, contributes to the compound's biological activity and potential applications in pharmaceuticals. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can be affected by the presence of the nitro and pyrazole substituents, which may also influence its pharmacokinetic properties. Overall, 3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid is a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C10H7N3O4
InChI:InChI=1S/C10H7N3O4/c14-10(15)7-2-3-8(9(6-7)13(16)17)12-5-1-4-11-12/h1-6H,(H,14,15)
InChI key:InChIKey=YPKLOOQBMQJXKS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC(C(O)=O)=C1)N2C=CC=N2
Synonyms:
  • Benzoic acid, 3-nitro-4-(1H-pyrazol-1-yl)-
  • 3-Nitro-4-(1-pyrazolyl)benzoic Acid
  • 3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid
Found 4 products.